C23H24FN5O3 — CID 57461512
6-[[3-cyclohexyl-2-(6-fluoro-4-oxoquinazolin-3-yl)propanoyl]amino]pyridine-3-carboxamide (PubChem CID 57461512) has the molecular formula C23H24FN5O3 and a molecular weight of 437.48 g/mol. Its IUPAC name is 6-[[3-cyclohexyl-2-(6-fluoro-4-oxoquinazolin-3-yl)propanoyl]amino]pyridine-3-carboxamide.
| Compound Name | 6-[[3-cyclohexyl-2-(6-fluoro-4-oxoquinazolin-3-yl)propanoyl]amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 57461512 |
| Molecular Formula | C23H24FN5O3 |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 6-[[3-cyclohexyl-2-(6-fluoro-4-oxoquinazolin-3-yl)propanoyl]amino]pyridine-3-carboxamide |
| SMILES | NC(=O)c1ccc(NC(=O)C(CC2CCCCC2)n2cnc3ccc(F)cc3c2=O)nc1 |
| InChI | InChI=1S/C23H24FN5O3/c24-16-7-8-18-17(11-16)23(32)29(13-27-18)19(10-14-4-2-1-3-5-14)22(31)28-20-9-6-15(12-26-20)21(25)30/h6-9,11-14,19H,1-5,10H2,(H2,25,30)(H,26,28,31) |
| InChIKey | LTQLFOPVAHHBCM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |