About 2,3-dihydroxydodecane-4,7-dione
2,3-dihydroxydodecane-4,7-dione (PubChem CID 57461625) has the molecular formula C12H22O4
and a molecular weight of 230.30 g/mol. Its IUPAC name is 2,3-dihydroxydodecane-4,7-dione.
Molecular Properties
| Compound Name | 2,3-dihydroxydodecane-4,7-dione |
| PubChem CID | 57461625 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 2,3-dihydroxydodecane-4,7-dione |
| SMILES | CCCCCC(=O)CCC(=O)C(O)C(C)O |
| InChI | InChI=1S/C12H22O4/c1-3-4-5-6-10(14)7-8-11(15)12(16)9(2)13/h9,12-13,16H,3-8H2,1-2H3 |
| InChIKey | DABGRVPOVJVANL-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dihydroxydodecane-4,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroxydodecane-4,7-dione?
The IUPAC name of 2,3-dihydroxydodecane-4,7-dione (CID 57461625) is 2,3-dihydroxydodecane-4,7-dione.
What is the SMILES notation for 2,3-dihydroxydodecane-4,7-dione?
The canonical SMILES for 2,3-dihydroxydodecane-4,7-dione is CCCCCC(=O)CCC(=O)C(O)C(C)O.
What is the InChIKey of 2,3-dihydroxydodecane-4,7-dione?
The InChIKey is DABGRVPOVJVANL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O4/c1-3-4-5-6-10(14)7-8-11(15)12(16)9(2)13/h9,12-13,16H,3-8H2,1-2H3.
What are the key properties of 2,3-dihydroxydodecane-4,7-dione?
2,3-dihydroxydodecane-4,7-dione has a molecular weight of 230.30 g/mol, XLogP of 1.23, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxydodecane-4,7-dione is sourced from PubChem (CID 57461625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).