About (2R)-1-[4-(2-fluoro-2,2-dimethoxyethyl)phenyl]propan-2-amine
(2R)-1-[4-(2-fluoro-2,2-dimethoxyethyl)phenyl]propan-2-amine (PubChem CID 57461931) has the molecular formula C13H20FNO2
and a molecular weight of 241.31 g/mol. Its IUPAC name is (2R)-1-[4-(2-fluoro-2,2-dimethoxyethyl)phenyl]propan-2-amine.
Molecular Properties
| Compound Name | (2R)-1-[4-(2-fluoro-2,2-dimethoxyethyl)phenyl]propan-2-amine |
| PubChem CID | 57461931 |
| Molecular Formula | C13H20FNO2 |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | (2R)-1-[4-(2-fluoro-2,2-dimethoxyethyl)phenyl]propan-2-amine |
| SMILES | COC(F)(Cc1ccc(C[C@@H](C)N)cc1)OC |
| InChI | InChI=1S/C13H20FNO2/c1-10(15)8-11-4-6-12(7-5-11)9-13(14,16-2)17-3/h4-7,10H,8-9,15H2,1-3H3/t10-/m1/s1 |
| InChIKey | YQJZECKRJOPSTG-SNVBAGLBSA-N |
| XLogP | 2.03 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1-[4-(2-fluoro-2,2-dimethoxyethyl)phenyl]propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-[4-(2-fluoro-2,2-dimethoxyethyl)phenyl]propan-2-amine?
The IUPAC name of (2R)-1-[4-(2-fluoro-2,2-dimethoxyethyl)phenyl]propan-2-amine (CID 57461931) is (2R)-1-[4-(2-fluoro-2,2-dimethoxyethyl)phenyl]propan-2-amine.
What is the SMILES notation for (2R)-1-[4-(2-fluoro-2,2-dimethoxyethyl)phenyl]propan-2-amine?
The canonical SMILES for (2R)-1-[4-(2-fluoro-2,2-dimethoxyethyl)phenyl]propan-2-amine is COC(F)(Cc1ccc(C[C@@H](C)N)cc1)OC.
What is the InChIKey of (2R)-1-[4-(2-fluoro-2,2-dimethoxyethyl)phenyl]propan-2-amine?
The InChIKey is YQJZECKRJOPSTG-SNVBAGLBSA-N. The full InChI is InChI=1S/C13H20FNO2/c1-10(15)8-11-4-6-12(7-5-11)9-13(14,16-2)17-3/h4-7,10H,8-9,15H2,1-3H3/t10-/m1/s1.
What are the key properties of (2R)-1-[4-(2-fluoro-2,2-dimethoxyethyl)phenyl]propan-2-amine?
(2R)-1-[4-(2-fluoro-2,2-dimethoxyethyl)phenyl]propan-2-amine has a molecular weight of 241.31 g/mol, XLogP of 2.03, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-[4-(2-fluoro-2,2-dimethoxyethyl)phenyl]propan-2-amine is sourced from PubChem (CID 57461931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).