About 2-trimethylsilylethyl N-[(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]carbamate
2-trimethylsilylethyl N-[(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]carbamate (PubChem CID 57462031) has the molecular formula C16H34N2O3Si
and a molecular weight of 330.55 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-[(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]carbamate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl N-[(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]carbamate |
| PubChem CID | 57462031 |
| Molecular Formula | C16H34N2O3Si |
| Molecular Weight | 330.55 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 2-trimethylsilylethyl N-[(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]carbamate |
| SMILES | C[Si](C)(C)CCOC(=O)NC[C@H](O)[C@@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C16H34N2O3Si/c1-22(2,3)10-9-21-16(20)18-12-15(19)14(17)11-13-7-5-4-6-8-13/h13-15,19H,4-12,17H2,1-3H3,(H,18,20)/t14-,15-/m0/s1 |
| InChIKey | BJVFYWNZJNAYPT-GJZGRUSLSA-N |
| XLogP | 2.71 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.55 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl N-[(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl N-[(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]carbamate?
The IUPAC name of 2-trimethylsilylethyl N-[(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]carbamate (CID 57462031) is 2-trimethylsilylethyl N-[(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]carbamate.
What is the SMILES notation for 2-trimethylsilylethyl N-[(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]carbamate?
The canonical SMILES for 2-trimethylsilylethyl N-[(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]carbamate is C[Si](C)(C)CCOC(=O)NC[C@H](O)[C@@H](N)CC1CCCCC1.
What is the InChIKey of 2-trimethylsilylethyl N-[(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]carbamate?
The InChIKey is BJVFYWNZJNAYPT-GJZGRUSLSA-N. The full InChI is InChI=1S/C16H34N2O3Si/c1-22(2,3)10-9-21-16(20)18-12-15(19)14(17)11-13-7-5-4-6-8-13/h13-15,19H,4-12,17H2,1-3H3,(H,18,20)/t14-,15-/m0/s1.
What are the key properties of 2-trimethylsilylethyl N-[(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]carbamate?
2-trimethylsilylethyl N-[(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]carbamate has a molecular weight of 330.55 g/mol, XLogP of 2.71, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl N-[(2S,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]carbamate is sourced from PubChem (CID 57462031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).