About 2-trimethylsilylethyl N-[(2R,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-N-methylcarbamate
2-trimethylsilylethyl N-[(2R,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-N-methylcarbamate (PubChem CID 57462033) has the molecular formula C17H36N2O3Si
and a molecular weight of 344.57 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-[(2R,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-N-methylcarbamate.
Molecular Properties
| Compound Name | 2-trimethylsilylethyl N-[(2R,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-N-methylcarbamate |
| PubChem CID | 57462033 |
| Molecular Formula | C17H36N2O3Si |
| Molecular Weight | 344.57 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | 2-trimethylsilylethyl N-[(2R,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-N-methylcarbamate |
| SMILES | CN(C[C@@H](O)[C@@H](N)CC1CCCCC1)C(=O)OCC[Si](C)(C)C |
| InChI | InChI=1S/C17H36N2O3Si/c1-19(17(21)22-10-11-23(2,3)4)13-16(20)15(18)12-14-8-6-5-7-9-14/h14-16,20H,5-13,18H2,1-4H3/t15-,16+/m0/s1 |
| InChIKey | HRGGPUGSTQBPCG-JKSUJKDBSA-N |
| XLogP | 3.05 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.57 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-trimethylsilylethyl N-[(2R,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trimethylsilylethyl N-[(2R,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-N-methylcarbamate?
The IUPAC name of 2-trimethylsilylethyl N-[(2R,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-N-methylcarbamate (CID 57462033) is 2-trimethylsilylethyl N-[(2R,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-N-methylcarbamate.
What is the SMILES notation for 2-trimethylsilylethyl N-[(2R,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-N-methylcarbamate?
The canonical SMILES for 2-trimethylsilylethyl N-[(2R,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-N-methylcarbamate is CN(C[C@@H](O)[C@@H](N)CC1CCCCC1)C(=O)OCC[Si](C)(C)C.
What is the InChIKey of 2-trimethylsilylethyl N-[(2R,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-N-methylcarbamate?
The InChIKey is HRGGPUGSTQBPCG-JKSUJKDBSA-N. The full InChI is InChI=1S/C17H36N2O3Si/c1-19(17(21)22-10-11-23(2,3)4)13-16(20)15(18)12-14-8-6-5-7-9-14/h14-16,20H,5-13,18H2,1-4H3/t15-,16+/m0/s1.
What are the key properties of 2-trimethylsilylethyl N-[(2R,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-N-methylcarbamate?
2-trimethylsilylethyl N-[(2R,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-N-methylcarbamate has a molecular weight of 344.57 g/mol, XLogP of 3.05, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trimethylsilylethyl N-[(2R,3S)-3-amino-4-cyclohexyl-2-hydroxybutyl]-N-methylcarbamate is sourced from PubChem (CID 57462033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).