About 4-[(E)-2-(3-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]benzene-1,2-diol iodide
4-[(E)-2-(3-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]benzene-1,2-diol iodide (PubChem CID 57462901) has the molecular formula C12H12INO2S
and a molecular weight of 361.20 g/mol. Its IUPAC name is 4-[(E)-2-(3-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]benzene-1,2-diol iodide.
Molecular Properties
| Compound Name | 4-[(E)-2-(3-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]benzene-1,2-diol iodide |
| PubChem CID | 57462901 |
| Molecular Formula | C12H12INO2S |
| Molecular Weight | 361.20 g/mol |
| Exact Mass | 360.96 |
| IUPAC Name | 4-[(E)-2-(3-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]benzene-1,2-diol iodide |
| SMILES | C[n+]1ccsc1/C=C/c1ccc(O)c(O)c1.[I-] |
| InChI | InChI=1S/C12H11NO2S.HI/c1-13-6-7-16-12(13)5-3-9-2-4-10(14)11(15)8-9;/h2-8,15H,1H3;1H |
| InChIKey | DWTVLTWWWFHRLC-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 44.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.20 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-2-(3-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]benzene-1,2-diol iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-(3-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]benzene-1,2-diol iodide?
The IUPAC name of 4-[(E)-2-(3-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]benzene-1,2-diol iodide (CID 57462901) is 4-[(E)-2-(3-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]benzene-1,2-diol iodide.
What is the SMILES notation for 4-[(E)-2-(3-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]benzene-1,2-diol iodide?
The canonical SMILES for 4-[(E)-2-(3-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]benzene-1,2-diol iodide is C[n+]1ccsc1/C=C/c1ccc(O)c(O)c1.[I-].
What is the InChIKey of 4-[(E)-2-(3-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]benzene-1,2-diol iodide?
The InChIKey is DWTVLTWWWFHRLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2S.HI/c1-13-6-7-16-12(13)5-3-9-2-4-10(14)11(15)8-9;/h2-8,15H,1H3;1H.
What are the key properties of 4-[(E)-2-(3-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]benzene-1,2-diol iodide?
4-[(E)-2-(3-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]benzene-1,2-diol iodide has a molecular weight of 361.20 g/mol, XLogP of -0.84, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-(3-methyl-1,3-thiazol-3-ium-2-yl)ethenyl]benzene-1,2-diol iodide is sourced from PubChem (CID 57462901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).