C25H26N4O2S — CID 57464227
methyl 4-[[5-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzoate (PubChem CID 57464227) has the molecular formula C25H26N4O2S and a molecular weight of 446.58 g/mol. Its IUPAC name is methyl 4-[[5-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzoate.
| Compound Name | methyl 4-[[5-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 57464227 |
| Molecular Formula | C25H26N4O2S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | methyl 4-[[5-[4-(2,5-dimethylpyrrol-1-yl)phenyl]-4-ethyl-1,2,4-triazol-3-yl]sulfanylmethyl]benzoate |
| SMILES | CCn1c(SCc2ccc(C(=O)OC)cc2)nnc1-c1ccc(-n2c(C)ccc2C)cc1 |
| InChI | InChI=1S/C25H26N4O2S/c1-5-28-23(20-12-14-22(15-13-20)29-17(2)6-7-18(29)3)26-27-25(28)32-16-19-8-10-21(11-9-19)24(30)31-4/h6-15H,5,16H2,1-4H3 |
| InChIKey | FWBBMKQKFJQKIC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|