About CID 57464318
CID 57464318 (PubChem CID 57464318) has the molecular formula C22H12BN2O2
and a molecular weight of 347.16 g/mol.
Molecular Properties
| Compound Name | CID 57464318 |
| PubChem CID | 57464318 |
| Molecular Formula | C22H12BN2O2 |
| Molecular Weight | 347.16 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | — |
| SMILES | N#Cc1ccc2c(O[B]Oc3cccc4cc(C#N)ccc34)cccc2c1 |
| InChI | InChI=1S/C22H12BN2O2/c24-13-15-7-9-19-17(11-15)3-1-5-21(19)26-23-27-22-6-2-4-18-12-16(14-25)8-10-20(18)22/h1-12H |
| InChIKey | BDSNOCALMKXSCS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.16 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 57464318 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57464318?
The IUPAC name of CID 57464318 (CID 57464318) is not available.
What is the SMILES notation for CID 57464318?
The canonical SMILES for CID 57464318 is N#Cc1ccc2c(O[B]Oc3cccc4cc(C#N)ccc34)cccc2c1.
What is the InChIKey of CID 57464318?
The InChIKey is BDSNOCALMKXSCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H12BN2O2/c24-13-15-7-9-19-17(11-15)3-1-5-21(19)26-23-27-22-6-2-4-18-12-16(14-25)8-10-20(18)22/h1-12H.
What are the key properties of CID 57464318?
CID 57464318 has a molecular weight of 347.16 g/mol, XLogP of 4.73, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57464318 is sourced from PubChem (CID 57464318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).