C3H7N5 — CID 574645
5-methyl-1,2,4-triazole-3,4-diamine (PubChem CID 574645) has the molecular formula C3H7N5 and a molecular weight of 113.12 g/mol. Its IUPAC name is 5-methyl-1,2,4-triazole-3,4-diamine.
| Compound Name | 5-methyl-1,2,4-triazole-3,4-diamine |
|---|---|
| PubChem CID | 574645 |
| Molecular Formula | C3H7N5 |
| Molecular Weight | 113.12 g/mol |
| Exact Mass | 113.07 |
| IUPAC Name | 5-methyl-1,2,4-triazole-3,4-diamine |
| SMILES | Cc1nnc(N)n1N |
| InChI | InChI=1S/C3H7N5/c1-2-6-7-3(4)8(2)5/h5H2,1H3,(H2,4,7) |
| InChIKey | UHOFPBXQUTZOKZ-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.12 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |