About 2-(9H-fluoren-9-yl)ethyl 4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzoate
2-(9H-fluoren-9-yl)ethyl 4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzoate (PubChem CID 57465433) has the molecular formula C36H26F3NO3
and a molecular weight of 577.60 g/mol. Its IUPAC name is 2-(9H-fluoren-9-yl)ethyl 4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzoate.
Molecular Properties
| Compound Name | 2-(9H-fluoren-9-yl)ethyl 4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzoate |
| PubChem CID | 57465433 |
| Molecular Formula | C36H26F3NO3 |
| Molecular Weight | 577.60 g/mol |
| Exact Mass | 577.19 |
| IUPAC Name | 2-(9H-fluoren-9-yl)ethyl 4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzoate |
| SMILES | O=C(OCCC1c2ccccc2-c2ccccc21)c1ccc(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C36H26F3NO3/c37-36(38,39)25-17-13-23(14-18-25)27-7-1-6-12-33(27)34(41)40-26-19-15-24(16-20-26)35(42)43-22-21-32-30-10-4-2-8-28(30)29-9-3-5-11-31(29)32/h1-20,32H,21-22H2,(H,40,41) |
| InChIKey | HLUWFXKPBGTSOT-UHFFFAOYSA-N |
| XLogP | 8.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 577.60 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(9H-fluoren-9-yl)ethyl 4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(9H-fluoren-9-yl)ethyl 4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzoate?
The IUPAC name of 2-(9H-fluoren-9-yl)ethyl 4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzoate (CID 57465433) is 2-(9H-fluoren-9-yl)ethyl 4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzoate.
What is the SMILES notation for 2-(9H-fluoren-9-yl)ethyl 4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzoate?
The canonical SMILES for 2-(9H-fluoren-9-yl)ethyl 4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzoate is O=C(OCCC1c2ccccc2-c2ccccc21)c1ccc(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)cc1.
What is the InChIKey of 2-(9H-fluoren-9-yl)ethyl 4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzoate?
The InChIKey is HLUWFXKPBGTSOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H26F3NO3/c37-36(38,39)25-17-13-23(14-18-25)27-7-1-6-12-33(27)34(41)40-26-19-15-24(16-20-26)35(42)43-22-21-32-30-10-4-2-8-28(30)29-9-3-5-11-31(29)32/h1-20,32H,21-22H2,(H,40,41).
What are the key properties of 2-(9H-fluoren-9-yl)ethyl 4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzoate?
2-(9H-fluoren-9-yl)ethyl 4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzoate has a molecular weight of 577.60 g/mol, XLogP of 8.98, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(9H-fluoren-9-yl)ethyl 4-[[2-[4-(trifluoromethyl)phenyl]benzoyl]amino]benzoate is sourced from PubChem (CID 57465433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).