C24H47NO — CID 574656
3,7,11,15-tetramethyl-1-pyrrolidin-1-ylhexadecan-1-one (PubChem CID 574656) has the molecular formula C24H47NO and a molecular weight of 365.65 g/mol. Its IUPAC name is 3,7,11,15-tetramethyl-1-pyrrolidin-1-ylhexadecan-1-one.
| Compound Name | 3,7,11,15-tetramethyl-1-pyrrolidin-1-ylhexadecan-1-one |
|---|---|
| PubChem CID | 574656 |
| Molecular Formula | C24H47NO |
| Molecular Weight | 365.65 g/mol |
| Exact Mass | 365.37 |
| IUPAC Name | 3,7,11,15-tetramethyl-1-pyrrolidin-1-ylhexadecan-1-one |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CC(=O)N1CCCC1 |
| InChI | InChI=1S/C24H47NO/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-16-23(5)19-24(26)25-17-6-7-18-25/h20-23H,6-19H2,1-5H3 |
| InChIKey | KBENWCSBIJHQTR-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.65 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |