C10H8Cl4O4 — CID 57465818
ethyl 2-(2,3,5,6-tetrachloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate (PubChem CID 57465818) has the molecular formula C10H8Cl4O4 and a molecular weight of 333.98 g/mol. Its IUPAC name is ethyl 2-(2,3,5,6-tetrachloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate.
| Compound Name | ethyl 2-(2,3,5,6-tetrachloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate |
|---|---|
| PubChem CID | 57465818 |
| Molecular Formula | C10H8Cl4O4 |
| Molecular Weight | 333.98 g/mol |
| Exact Mass | 331.92 |
| IUPAC Name | ethyl 2-(2,3,5,6-tetrachloro-1-hydroxy-4-oxocyclohexa-2,5-dien-1-yl)acetate |
| SMILES | CCOC(=O)CC1(O)C(Cl)=C(Cl)C(=O)C(Cl)=C1Cl |
| InChI | InChI=1S/C10H8Cl4O4/c1-2-18-4(15)3-10(17)8(13)5(11)7(16)6(12)9(10)14/h17H,2-3H2,1H3 |
| InChIKey | SLLCRXDAMDHQMU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.98 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|