About pyrimido[1,2-a]pyrimidine
pyrimido[1,2-a]pyrimidine (PubChem CID 57465833) has the molecular formula C7H5N3
and a molecular weight of 131.14 g/mol. Its IUPAC name is pyrimido[1,2-a]pyrimidine.
Molecular Properties
| Compound Name | pyrimido[1,2-a]pyrimidine |
| PubChem CID | 57465833 |
| Molecular Formula | C7H5N3 |
| Molecular Weight | 131.14 g/mol |
| Exact Mass | 131.05 |
| IUPAC Name | pyrimido[1,2-a]pyrimidine |
| SMILES | C1=CN=C2N=CC=CN2C=1 |
| InChI | InChI=1S/C7H5N3/c1-3-8-7-9-4-2-6-10(7)5-1/h1,3-6H |
| InChIKey | MDTDXIBWTUXGEG-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.14 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrimido[1,2-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrimido[1,2-a]pyrimidine?
The IUPAC name of pyrimido[1,2-a]pyrimidine (CID 57465833) is pyrimido[1,2-a]pyrimidine.
What is the SMILES notation for pyrimido[1,2-a]pyrimidine?
The canonical SMILES for pyrimido[1,2-a]pyrimidine is C1=CN=C2N=CC=CN2C=1.
What is the InChIKey of pyrimido[1,2-a]pyrimidine?
The InChIKey is MDTDXIBWTUXGEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3/c1-3-8-7-9-4-2-6-10(7)5-1/h1,3-6H.
What are the key properties of pyrimido[1,2-a]pyrimidine?
pyrimido[1,2-a]pyrimidine has a molecular weight of 131.14 g/mol, XLogP of 0.88, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrimido[1,2-a]pyrimidine is sourced from PubChem (CID 57465833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).