C19H16BrFN2O3 — CID 57466618
6-bromo-2-[(4-fluorophenyl)methyl]-2-methylspiro[3H-chromene-4,5'-imidazolidine]-2',4'-dione (PubChem CID 57466618) has the molecular formula C19H16BrFN2O3 and a molecular weight of 419.25 g/mol. Its IUPAC name is 6-bromo-2-[(4-fluorophenyl)methyl]-2-methylspiro[3H-chromene-4,5'-imidazolidine]-2',4'-dione.
| Compound Name | 6-bromo-2-[(4-fluorophenyl)methyl]-2-methylspiro[3H-chromene-4,5'-imidazolidine]-2',4'-dione |
|---|---|
| PubChem CID | 57466618 |
| Molecular Formula | C19H16BrFN2O3 |
| Molecular Weight | 419.25 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | 6-bromo-2-[(4-fluorophenyl)methyl]-2-methylspiro[3H-chromene-4,5'-imidazolidine]-2',4'-dione |
| SMILES | CC1(Cc2ccc(F)cc2)CC2(NC(=O)NC2=O)c2cc(Br)ccc2O1 |
| InChI | InChI=1S/C19H16BrFN2O3/c1-18(9-11-2-5-13(21)6-3-11)10-19(16(24)22-17(25)23-19)14-8-12(20)4-7-15(14)26-18/h2-8H,9-10H2,1H3,(H2,22,23,24,25) |
| InChIKey | VVWQXLFIEQVJSA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.25 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|