C23H24Cl2F3NO5S — CID 57467209
[8-[(3,4-dichlorophenyl)methyl]-7-[(2-methylpropan-2-yl)oxycarbonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate (PubChem CID 57467209) has the molecular formula C23H24Cl2F3NO5S and a molecular weight of 554.41 g/mol. Its IUPAC name is [8-[(3,4-dichlorophenyl)methyl]-7-[(2-methylpropan-2-yl)oxycarbonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate.
| Compound Name | [8-[(3,4-dichlorophenyl)methyl]-7-[(2-methylpropan-2-yl)oxycarbonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 57467209 |
| Molecular Formula | C23H24Cl2F3NO5S |
| Molecular Weight | 554.41 g/mol |
| Exact Mass | 553.07 |
| IUPAC Name | [8-[(3,4-dichlorophenyl)methyl]-7-[(2-methylpropan-2-yl)oxycarbonylamino]-5,6,7,8-tetrahydronaphthalen-2-yl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)OC(=O)NC1CCc2ccc(OS(=O)(=O)C(F)(F)F)cc2C1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H24Cl2F3NO5S/c1-22(2,3)33-21(30)29-20-9-6-14-5-7-15(34-35(31,32)23(26,27)28)12-16(14)17(20)10-13-4-8-18(24)19(25)11-13/h4-5,7-8,11-12,17,20H,6,9-10H2,1-3H3,(H,29,30) |
| InChIKey | AAEVWFGBCUOANY-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.41 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|