C25H28N2O3S — CID 57467243
N-[2-[(7-amino-8-benzyl-5,6,7,8-tetrahydronaphthalen-2-yl)oxy]ethyl]benzenesulfonamide (PubChem CID 57467243) has the molecular formula C25H28N2O3S and a molecular weight of 436.58 g/mol. Its IUPAC name is N-[2-[(7-amino-8-benzyl-5,6,7,8-tetrahydronaphthalen-2-yl)oxy]ethyl]benzenesulfonamide.
| Compound Name | N-[2-[(7-amino-8-benzyl-5,6,7,8-tetrahydronaphthalen-2-yl)oxy]ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 57467243 |
| Molecular Formula | C25H28N2O3S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | N-[2-[(7-amino-8-benzyl-5,6,7,8-tetrahydronaphthalen-2-yl)oxy]ethyl]benzenesulfonamide |
| SMILES | NC1CCc2ccc(OCCNS(=O)(=O)c3ccccc3)cc2C1Cc1ccccc1 |
| InChI | InChI=1S/C25H28N2O3S/c26-25-14-12-20-11-13-21(18-23(20)24(25)17-19-7-3-1-4-8-19)30-16-15-27-31(28,29)22-9-5-2-6-10-22/h1-11,13,18,24-25,27H,12,14-17,26H2 |
| InChIKey | WPZBXZGOUNJUGW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|