C27H36N2O3S — CID 57467260
N-[2-[(8-benzyl-7-pyrrolidin-1-yl-5,6,7,8-tetrahydronaphthalen-2-yl)oxy]ethyl]-1-cyclopropylmethanesulfonamide (PubChem CID 57467260) has the molecular formula C27H36N2O3S and a molecular weight of 468.66 g/mol. Its IUPAC name is N-[2-[(8-benzyl-7-pyrrolidin-1-yl-5,6,7,8-tetrahydronaphthalen-2-yl)oxy]ethyl]-1-cyclopropylmethanesulfonamide.
| Compound Name | N-[2-[(8-benzyl-7-pyrrolidin-1-yl-5,6,7,8-tetrahydronaphthalen-2-yl)oxy]ethyl]-1-cyclopropylmethanesulfonamide |
|---|---|
| PubChem CID | 57467260 |
| Molecular Formula | C27H36N2O3S |
| Molecular Weight | 468.66 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | N-[2-[(8-benzyl-7-pyrrolidin-1-yl-5,6,7,8-tetrahydronaphthalen-2-yl)oxy]ethyl]-1-cyclopropylmethanesulfonamide |
| SMILES | O=S(=O)(CC1CC1)NCCOc1ccc2c(c1)C(Cc1ccccc1)C(N1CCCC1)CC2 |
| InChI | InChI=1S/C27H36N2O3S/c30-33(31,20-22-8-9-22)28-14-17-32-24-12-10-23-11-13-27(29-15-4-5-16-29)26(25(23)19-24)18-21-6-2-1-3-7-21/h1-3,6-7,10,12,19,22,26-28H,4-5,8-9,11,13-18,20H2 |
| InChIKey | FJYJEQLNBGCTMQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.66 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|