C23H32N2O2S — CID 57467317
N-[3-(7-amino-8-benzyl-5,6,7,8-tetrahydronaphthalen-2-yl)propyl]propane-1-sulfonamide (PubChem CID 57467317) has the molecular formula C23H32N2O2S and a molecular weight of 400.59 g/mol. Its IUPAC name is N-[3-(7-amino-8-benzyl-5,6,7,8-tetrahydronaphthalen-2-yl)propyl]propane-1-sulfonamide.
| Compound Name | N-[3-(7-amino-8-benzyl-5,6,7,8-tetrahydronaphthalen-2-yl)propyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 57467317 |
| Molecular Formula | C23H32N2O2S |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | N-[3-(7-amino-8-benzyl-5,6,7,8-tetrahydronaphthalen-2-yl)propyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NCCCc1ccc2c(c1)C(Cc1ccccc1)C(N)CC2 |
| InChI | InChI=1S/C23H32N2O2S/c1-2-15-28(26,27)25-14-6-9-19-10-11-20-12-13-23(24)22(21(20)16-19)17-18-7-4-3-5-8-18/h3-5,7-8,10-11,16,22-23,25H,2,6,9,12-15,17,24H2,1H3 |
| InChIKey | RDDVYKBDIYAHDT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|