C20H23Cl2NO — CID 57467647
5-chloro-4-[4-(chloromethyl)-2-[(1R)-2,2-dimethylcyclopentyl]phenyl]-2-methoxypyridine (PubChem CID 57467647) has the molecular formula C20H23Cl2NO and a molecular weight of 364.32 g/mol. Its IUPAC name is 5-chloro-4-[4-(chloromethyl)-2-[(1R)-2,2-dimethylcyclopentyl]phenyl]-2-methoxypyridine.
| Compound Name | 5-chloro-4-[4-(chloromethyl)-2-[(1R)-2,2-dimethylcyclopentyl]phenyl]-2-methoxypyridine |
|---|---|
| PubChem CID | 57467647 |
| Molecular Formula | C20H23Cl2NO |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 5-chloro-4-[4-(chloromethyl)-2-[(1R)-2,2-dimethylcyclopentyl]phenyl]-2-methoxypyridine |
| SMILES | COc1cc(-c2ccc(CCl)cc2[C@@H]2CCCC2(C)C)c(Cl)cn1 |
| InChI | InChI=1S/C20H23Cl2NO/c1-20(2)8-4-5-17(20)15-9-13(11-21)6-7-14(15)16-10-19(24-3)23-12-18(16)22/h6-7,9-10,12,17H,4-5,8,11H2,1-3H3/t17-/m0/s1 |
| InChIKey | AJHDWEQETBUSGB-KRWDZBQOSA-N |
| XLogP | 6.44 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|