About 4-methylnaphthalene-1,2,8-triamine
4-methylnaphthalene-1,2,8-triamine (PubChem CID 57467784) has the molecular formula C11H13N3
and a molecular weight of 187.25 g/mol. Its IUPAC name is 4-methylnaphthalene-1,2,8-triamine.
Molecular Properties
| Compound Name | 4-methylnaphthalene-1,2,8-triamine |
| PubChem CID | 57467784 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 4-methylnaphthalene-1,2,8-triamine |
| SMILES | Cc1cc(N)c(N)c2c(N)cccc12 |
| InChI | InChI=1S/C11H13N3/c1-6-5-9(13)11(14)10-7(6)3-2-4-8(10)12/h2-5H,12-14H2,1H3 |
| InChIKey | JVJVBWYGYZQEDH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-methylnaphthalene-1,2,8-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylnaphthalene-1,2,8-triamine?
The IUPAC name of 4-methylnaphthalene-1,2,8-triamine (CID 57467784) is 4-methylnaphthalene-1,2,8-triamine.
What is the SMILES notation for 4-methylnaphthalene-1,2,8-triamine?
The canonical SMILES for 4-methylnaphthalene-1,2,8-triamine is Cc1cc(N)c(N)c2c(N)cccc12.
What is the InChIKey of 4-methylnaphthalene-1,2,8-triamine?
The InChIKey is JVJVBWYGYZQEDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3/c1-6-5-9(13)11(14)10-7(6)3-2-4-8(10)12/h2-5H,12-14H2,1H3.
What are the key properties of 4-methylnaphthalene-1,2,8-triamine?
4-methylnaphthalene-1,2,8-triamine has a molecular weight of 187.25 g/mol, XLogP of 1.89, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylnaphthalene-1,2,8-triamine is sourced from PubChem (CID 57467784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).