C15H24N5+ — CID 57467852
2-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]pyrazolo[1,5-a]pyridine-2,3-diamine (PubChem CID 57467852) has the molecular formula C15H24N5+ and a molecular weight of 274.39 g/mol. Its IUPAC name is 2-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]pyrazolo[1,5-a]pyridine-2,3-diamine.
| Compound Name | 2-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]pyrazolo[1,5-a]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 57467852 |
| Molecular Formula | C15H24N5+ |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 2-N-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]pyrazolo[1,5-a]pyridine-2,3-diamine |
| SMILES | C[N+]1(CCNc2nn3ccccc3c2N)CCCCC1 |
| InChI | InChI=1S/C15H24N5/c1-20(10-5-2-6-11-20)12-8-17-15-14(16)13-7-3-4-9-19(13)18-15/h3-4,7,9H,2,5-6,8,10-12,16H2,1H3,(H,17,18)/q+1 |
| InChIKey | NMMSFBYRHVOEJT-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|