C23H32N7O3+ — CID 57467853
5-amino-4-[2-[2-(4,4-dimethylpiperazin-4-ium-1-yl)ethylamino]pyrazolo[1,5-a]pyridin-3-yl]imino-2-(2-hydroxyethoxy)cyclohexa-2,5-dien-1-one (PubChem CID 57467853) has the molecular formula C23H32N7O3+ and a molecular weight of 454.56 g/mol. Its IUPAC name is 5-amino-4-[2-[2-(4,4-dimethylpiperazin-4-ium-1-yl)ethylamino]pyrazolo[1,5-a]pyridin-3-yl]imino-2-(2-hydroxyethoxy)cyclohexa-2,5-dien-1-one.
| Compound Name | 5-amino-4-[2-[2-(4,4-dimethylpiperazin-4-ium-1-yl)ethylamino]pyrazolo[1,5-a]pyridin-3-yl]imino-2-(2-hydroxyethoxy)cyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 57467853 |
| Molecular Formula | C23H32N7O3+ |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | 5-amino-4-[2-[2-(4,4-dimethylpiperazin-4-ium-1-yl)ethylamino]pyrazolo[1,5-a]pyridin-3-yl]imino-2-(2-hydroxyethoxy)cyclohexa-2,5-dien-1-one |
| SMILES | C[N+]1(C)CCN(CCNc2nn3ccccc3c2/N=C2\C=C(OCCO)C(=O)C=C2N)CC1 |
| InChI | InChI=1S/C23H31N7O3/c1-30(2)11-9-28(10-12-30)8-6-25-23-22(19-5-3-4-7-29(19)27-23)26-18-16-21(33-14-13-31)20(32)15-17(18)24/h3-5,7,15-16,31H,6,8-14H2,1-2H3,(H2-,24,25,27,32)/p+1/b26-18+ |
| InChIKey | XXARQBPJDCVXRL-NLRVBDNBSA-O |
| XLogP | 0.53 |
| TPSA | 117.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|