About 2-(1-oxo-2,3-dihydroinden-5-yl)ethanethioic S-acid
2-(1-oxo-2,3-dihydroinden-5-yl)ethanethioic S-acid (PubChem CID 57468297) has the molecular formula C11H10O2S
and a molecular weight of 206.27 g/mol. Its IUPAC name is 2-(1-oxo-2,3-dihydroinden-5-yl)ethanethioic S-acid.
Molecular Properties
| Compound Name | 2-(1-oxo-2,3-dihydroinden-5-yl)ethanethioic S-acid |
| PubChem CID | 57468297 |
| Molecular Formula | C11H10O2S |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | 2-(1-oxo-2,3-dihydroinden-5-yl)ethanethioic S-acid |
| SMILES | O=C(S)Cc1ccc2c(c1)CCC2=O |
| InChI | InChI=1S/C11H10O2S/c12-10-4-2-8-5-7(6-11(13)14)1-3-9(8)10/h1,3,5H,2,4,6H2,(H,13,14) |
| InChIKey | QCCYLUXFHBOGMP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-oxo-2,3-dihydroinden-5-yl)ethanethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-oxo-2,3-dihydroinden-5-yl)ethanethioic S-acid?
The IUPAC name of 2-(1-oxo-2,3-dihydroinden-5-yl)ethanethioic S-acid (CID 57468297) is 2-(1-oxo-2,3-dihydroinden-5-yl)ethanethioic S-acid.
What is the SMILES notation for 2-(1-oxo-2,3-dihydroinden-5-yl)ethanethioic S-acid?
The canonical SMILES for 2-(1-oxo-2,3-dihydroinden-5-yl)ethanethioic S-acid is O=C(S)Cc1ccc2c(c1)CCC2=O.
What is the InChIKey of 2-(1-oxo-2,3-dihydroinden-5-yl)ethanethioic S-acid?
The InChIKey is QCCYLUXFHBOGMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O2S/c12-10-4-2-8-5-7(6-11(13)14)1-3-9(8)10/h1,3,5H,2,4,6H2,(H,13,14).
What are the key properties of 2-(1-oxo-2,3-dihydroinden-5-yl)ethanethioic S-acid?
2-(1-oxo-2,3-dihydroinden-5-yl)ethanethioic S-acid has a molecular weight of 206.27 g/mol, XLogP of 1.81, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-oxo-2,3-dihydroinden-5-yl)ethanethioic S-acid is sourced from PubChem (CID 57468297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).