About 2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]pyrazolo[1,5-a]pyridin-3-amine
2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]pyrazolo[1,5-a]pyridin-3-amine (PubChem CID 57469281) has the molecular formula C15H23N4O+
and a molecular weight of 275.38 g/mol. Its IUPAC name is 2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]pyrazolo[1,5-a]pyridin-3-amine.
Molecular Properties
| Compound Name | 2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]pyrazolo[1,5-a]pyridin-3-amine |
| PubChem CID | 57469281 |
| Molecular Formula | C15H23N4O+ |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]pyrazolo[1,5-a]pyridin-3-amine |
| SMILES | C[N+]1(CCOc2nn3ccccc3c2N)CCCCC1 |
| InChI | InChI=1S/C15H23N4O/c1-19(9-5-2-6-10-19)11-12-20-15-14(16)13-7-3-4-8-18(13)17-15/h3-4,7-8H,2,5-6,9-12,16H2,1H3/q+1 |
| InChIKey | ALEHWURVHJMJMT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]pyrazolo[1,5-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]pyrazolo[1,5-a]pyridin-3-amine?
The IUPAC name of 2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]pyrazolo[1,5-a]pyridin-3-amine (CID 57469281) is 2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]pyrazolo[1,5-a]pyridin-3-amine.
What is the SMILES notation for 2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]pyrazolo[1,5-a]pyridin-3-amine?
The canonical SMILES for 2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]pyrazolo[1,5-a]pyridin-3-amine is C[N+]1(CCOc2nn3ccccc3c2N)CCCCC1.
What is the InChIKey of 2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]pyrazolo[1,5-a]pyridin-3-amine?
The InChIKey is ALEHWURVHJMJMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N4O/c1-19(9-5-2-6-10-19)11-12-20-15-14(16)13-7-3-4-8-18(13)17-15/h3-4,7-8H,2,5-6,9-12,16H2,1H3/q+1.
What are the key properties of 2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]pyrazolo[1,5-a]pyridin-3-amine?
2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]pyrazolo[1,5-a]pyridin-3-amine has a molecular weight of 275.38 g/mol, XLogP of 1.93, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1-methylpiperidin-1-ium-1-yl)ethoxy]pyrazolo[1,5-a]pyridin-3-amine is sourced from PubChem (CID 57469281), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).