About [1,3]oxazolo[2,3-c][1,4]benzodiazepine
[1,3]oxazolo[2,3-c][1,4]benzodiazepine (PubChem CID 57469474) has the molecular formula C11H8N2O
and a molecular weight of 184.20 g/mol. Its IUPAC name is [1,3]oxazolo[2,3-c][1,4]benzodiazepine.
Molecular Properties
| Compound Name | [1,3]oxazolo[2,3-c][1,4]benzodiazepine |
| PubChem CID | 57469474 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | [1,3]oxazolo[2,3-c][1,4]benzodiazepine |
| SMILES | C1=CN2C=c3ccccc3=NC=C2O1 |
| InChI | InChI=1S/C11H8N2O/c1-2-4-10-9(3-1)8-13-5-6-14-11(13)7-12-10/h1-8H |
| InChIKey | ZTEDYJOYKIHTGP-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1,3]oxazolo[2,3-c][1,4]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3]oxazolo[2,3-c][1,4]benzodiazepine?
The IUPAC name of [1,3]oxazolo[2,3-c][1,4]benzodiazepine (CID 57469474) is [1,3]oxazolo[2,3-c][1,4]benzodiazepine.
What is the SMILES notation for [1,3]oxazolo[2,3-c][1,4]benzodiazepine?
The canonical SMILES for [1,3]oxazolo[2,3-c][1,4]benzodiazepine is C1=CN2C=c3ccccc3=NC=C2O1.
What is the InChIKey of [1,3]oxazolo[2,3-c][1,4]benzodiazepine?
The InChIKey is ZTEDYJOYKIHTGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O/c1-2-4-10-9(3-1)8-13-5-6-14-11(13)7-12-10/h1-8H.
What are the key properties of [1,3]oxazolo[2,3-c][1,4]benzodiazepine?
[1,3]oxazolo[2,3-c][1,4]benzodiazepine has a molecular weight of 184.20 g/mol, XLogP of 0.66, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3]oxazolo[2,3-c][1,4]benzodiazepine is sourced from PubChem (CID 57469474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).