About 1'-(2,3-dichloro-4-pyridinyl)spiro[1H-2-benzofuran-3,4'-piperidine]
1'-(2,3-dichloro-4-pyridinyl)spiro[1H-2-benzofuran-3,4'-piperidine] (PubChem CID 57470420) has the molecular formula C17H16Cl2N2O
and a molecular weight of 335.23 g/mol. Its IUPAC name is 1'-(2,3-dichloro-4-pyridinyl)spiro[1H-2-benzofuran-3,4'-piperidine].
Molecular Properties
| Compound Name | 1'-(2,3-dichloro-4-pyridinyl)spiro[1H-2-benzofuran-3,4'-piperidine] |
| PubChem CID | 57470420 |
| Molecular Formula | C17H16Cl2N2O |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 1'-(2,3-dichloro-4-pyridinyl)spiro[1H-2-benzofuran-3,4'-piperidine] |
| SMILES | Clc1nccc(N2CCC3(CC2)OCc2ccccc23)c1Cl |
| InChI | InChI=1S/C17H16Cl2N2O/c18-15-14(5-8-20-16(15)19)21-9-6-17(7-10-21)13-4-2-1-3-12(13)11-22-17/h1-5,8H,6-7,9-11H2 |
| InChIKey | KFMMCFSPRZLGTQ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1'-(2,3-dichloro-4-pyridinyl)spiro[1H-2-benzofuran-3,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-(2,3-dichloro-4-pyridinyl)spiro[1H-2-benzofuran-3,4'-piperidine]?
The IUPAC name of 1'-(2,3-dichloro-4-pyridinyl)spiro[1H-2-benzofuran-3,4'-piperidine] (CID 57470420) is 1'-(2,3-dichloro-4-pyridinyl)spiro[1H-2-benzofuran-3,4'-piperidine].
What is the SMILES notation for 1'-(2,3-dichloro-4-pyridinyl)spiro[1H-2-benzofuran-3,4'-piperidine]?
The canonical SMILES for 1'-(2,3-dichloro-4-pyridinyl)spiro[1H-2-benzofuran-3,4'-piperidine] is Clc1nccc(N2CCC3(CC2)OCc2ccccc23)c1Cl.
What is the InChIKey of 1'-(2,3-dichloro-4-pyridinyl)spiro[1H-2-benzofuran-3,4'-piperidine]?
The InChIKey is KFMMCFSPRZLGTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16Cl2N2O/c18-15-14(5-8-20-16(15)19)21-9-6-17(7-10-21)13-4-2-1-3-12(13)11-22-17/h1-5,8H,6-7,9-11H2.
What are the key properties of 1'-(2,3-dichloro-4-pyridinyl)spiro[1H-2-benzofuran-3,4'-piperidine]?
1'-(2,3-dichloro-4-pyridinyl)spiro[1H-2-benzofuran-3,4'-piperidine] has a molecular weight of 335.23 g/mol, XLogP of 4.41, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-(2,3-dichloro-4-pyridinyl)spiro[1H-2-benzofuran-3,4'-piperidine] is sourced from PubChem (CID 57470420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).