C24H32ClF2NO3 — CID 57470586
3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-[(2-methyl-6-phenylhexan-2-yl)amino]ethyl]phenyl]propanoic acid;hydrochloride (PubChem CID 57470586) has the molecular formula C24H32ClF2NO3 and a molecular weight of 455.97 g/mol. Its IUPAC name is 3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-[(2-methyl-6-phenylhexan-2-yl)amino]ethyl]phenyl]propanoic acid;hydrochloride.
| Compound Name | 3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-[(2-methyl-6-phenylhexan-2-yl)amino]ethyl]phenyl]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 57470586 |
| Molecular Formula | C24H32ClF2NO3 |
| Molecular Weight | 455.97 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 3-[3,4-difluoro-5-[(1S)-1-hydroxy-2-[(2-methyl-6-phenylhexan-2-yl)amino]ethyl]phenyl]propanoic acid;hydrochloride |
| SMILES | CC(C)(CCCCc1ccccc1)NC[C@@H](O)c1cc(CCC(=O)O)cc(F)c1F.Cl |
| InChI | InChI=1S/C24H31F2NO3.ClH/c1-24(2,13-7-6-10-17-8-4-3-5-9-17)27-16-21(28)19-14-18(11-12-22(29)30)15-20(25)23(19)26;/h3-5,8-9,14-15,21,27-28H,6-7,10-13,16H2,1-2H3,(H,29,30);1H/t21-;/m1./s1 |
| InChIKey | OCJWRMSQPGOUQM-ZMBIFBSDSA-N |
| XLogP | 5.22 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.97 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|