C24H32Cl2N2O3S — CID 57471260
N-[2-[[7-amino-8-[(3,4-dichlorophenyl)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]ethyl]pentane-1-sulfonamide (PubChem CID 57471260) has the molecular formula C24H32Cl2N2O3S and a molecular weight of 499.50 g/mol. Its IUPAC name is N-[2-[[7-amino-8-[(3,4-dichlorophenyl)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]ethyl]pentane-1-sulfonamide.
| Compound Name | N-[2-[[7-amino-8-[(3,4-dichlorophenyl)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]ethyl]pentane-1-sulfonamide |
|---|---|
| PubChem CID | 57471260 |
| Molecular Formula | C24H32Cl2N2O3S |
| Molecular Weight | 499.50 g/mol |
| Exact Mass | 498.15 |
| IUPAC Name | N-[2-[[7-amino-8-[(3,4-dichlorophenyl)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]oxy]ethyl]pentane-1-sulfonamide |
| SMILES | CCCCCS(=O)(=O)NCCOc1ccc2c(c1)C(Cc1ccc(Cl)c(Cl)c1)C(N)CC2 |
| InChI | InChI=1S/C24H32Cl2N2O3S/c1-2-3-4-13-32(29,30)28-11-12-31-19-8-6-18-7-10-24(27)21(20(18)16-19)14-17-5-9-22(25)23(26)15-17/h5-6,8-9,15-16,21,24,28H,2-4,7,10-14,27H2,1H3 |
| InChIKey | RHCDODZKXZSAMU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|