C22H30N2O3S — CID 57471298
N-[2-[(7-amino-8-benzyl-5,6,7,8-tetrahydronaphthalen-2-yl)oxy]ethyl]propane-1-sulfonamide (PubChem CID 57471298) has the molecular formula C22H30N2O3S and a molecular weight of 402.56 g/mol. Its IUPAC name is N-[2-[(7-amino-8-benzyl-5,6,7,8-tetrahydronaphthalen-2-yl)oxy]ethyl]propane-1-sulfonamide.
| Compound Name | N-[2-[(7-amino-8-benzyl-5,6,7,8-tetrahydronaphthalen-2-yl)oxy]ethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 57471298 |
| Molecular Formula | C22H30N2O3S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | N-[2-[(7-amino-8-benzyl-5,6,7,8-tetrahydronaphthalen-2-yl)oxy]ethyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NCCOc1ccc2c(c1)C(Cc1ccccc1)C(N)CC2 |
| InChI | InChI=1S/C22H30N2O3S/c1-2-14-28(25,26)24-12-13-27-19-10-8-18-9-11-22(23)21(20(18)16-19)15-17-6-4-3-5-7-17/h3-8,10,16,21-22,24H,2,9,11-15,23H2,1H3 |
| InChIKey | UKMNCAVNVBIFOX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|