C23H30F2N2O2S — CID 57471350
N-[3-[7-amino-8-[(3,4-difluorophenyl)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]propyl]propane-1-sulfonamide (PubChem CID 57471350) has the molecular formula C23H30F2N2O2S and a molecular weight of 436.57 g/mol. Its IUPAC name is N-[3-[7-amino-8-[(3,4-difluorophenyl)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]propyl]propane-1-sulfonamide.
| Compound Name | N-[3-[7-amino-8-[(3,4-difluorophenyl)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]propyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 57471350 |
| Molecular Formula | C23H30F2N2O2S |
| Molecular Weight | 436.57 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | N-[3-[7-amino-8-[(3,4-difluorophenyl)methyl]-5,6,7,8-tetrahydronaphthalen-2-yl]propyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NCCCc1ccc2c(c1)C(Cc1ccc(F)c(F)c1)C(N)CC2 |
| InChI | InChI=1S/C23H30F2N2O2S/c1-2-12-30(28,29)27-11-3-4-16-5-7-18-8-10-23(26)20(19(18)13-16)14-17-6-9-21(24)22(25)15-17/h5-7,9,13,15,20,23,27H,2-4,8,10-12,14,26H2,1H3 |
| InChIKey | MKHJADDECCYHKH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|