C25H33FN2O3S — CID 57471362
N-[1-[(3-fluorophenyl)methyl]-7-[3-(propylsulfonylamino)propyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetamide (PubChem CID 57471362) has the molecular formula C25H33FN2O3S and a molecular weight of 460.62 g/mol. Its IUPAC name is N-[1-[(3-fluorophenyl)methyl]-7-[3-(propylsulfonylamino)propyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetamide.
| Compound Name | N-[1-[(3-fluorophenyl)methyl]-7-[3-(propylsulfonylamino)propyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetamide |
|---|---|
| PubChem CID | 57471362 |
| Molecular Formula | C25H33FN2O3S |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | N-[1-[(3-fluorophenyl)methyl]-7-[3-(propylsulfonylamino)propyl]-1,2,3,4-tetrahydronaphthalen-2-yl]acetamide |
| SMILES | CCCS(=O)(=O)NCCCc1ccc2c(c1)C(Cc1cccc(F)c1)C(NC(C)=O)CC2 |
| InChI | InChI=1S/C25H33FN2O3S/c1-3-14-32(30,31)27-13-5-7-19-9-10-21-11-12-25(28-18(2)29)24(23(21)16-19)17-20-6-4-8-22(26)15-20/h4,6,8-10,15-16,24-25,27H,3,5,7,11-14,17H2,1-2H3,(H,28,29) |
| InChIKey | QPFQUKFRKAONTL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|