C25H27F2N3O4S — CID 57471430
N-[1-[(3,5-difluorophenyl)methyl]-7-[2-[(1-methylpyrrol-3-yl)sulfonylamino]ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]formamide (PubChem CID 57471430) has the molecular formula C25H27F2N3O4S and a molecular weight of 503.57 g/mol. Its IUPAC name is N-[1-[(3,5-difluorophenyl)methyl]-7-[2-[(1-methylpyrrol-3-yl)sulfonylamino]ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]formamide.
| Compound Name | N-[1-[(3,5-difluorophenyl)methyl]-7-[2-[(1-methylpyrrol-3-yl)sulfonylamino]ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]formamide |
|---|---|
| PubChem CID | 57471430 |
| Molecular Formula | C25H27F2N3O4S |
| Molecular Weight | 503.57 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | N-[1-[(3,5-difluorophenyl)methyl]-7-[2-[(1-methylpyrrol-3-yl)sulfonylamino]ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]formamide |
| SMILES | Cn1ccc(S(=O)(=O)NCCOc2ccc3c(c2)C(Cc2cc(F)cc(F)c2)C(NC=O)CC3)c1 |
| InChI | InChI=1S/C25H27F2N3O4S/c1-30-8-6-22(15-30)35(32,33)29-7-9-34-21-4-2-18-3-5-25(28-16-31)24(23(18)14-21)12-17-10-19(26)13-20(27)11-17/h2,4,6,8,10-11,13-16,24-25,29H,3,5,7,9,12H2,1H3,(H,28,31) |
| InChIKey | ZPKTZZFUEATCLU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.57 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|