C27H31F2N3O5S — CID 57471431
ethyl N-[1-[(3,5-difluorophenyl)methyl]-7-[2-[(1-methylpyrrol-3-yl)sulfonylamino]ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate (PubChem CID 57471431) has the molecular formula C27H31F2N3O5S and a molecular weight of 547.62 g/mol. Its IUPAC name is ethyl N-[1-[(3,5-difluorophenyl)methyl]-7-[2-[(1-methylpyrrol-3-yl)sulfonylamino]ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate.
| Compound Name | ethyl N-[1-[(3,5-difluorophenyl)methyl]-7-[2-[(1-methylpyrrol-3-yl)sulfonylamino]ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate |
|---|---|
| PubChem CID | 57471431 |
| Molecular Formula | C27H31F2N3O5S |
| Molecular Weight | 547.62 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | ethyl N-[1-[(3,5-difluorophenyl)methyl]-7-[2-[(1-methylpyrrol-3-yl)sulfonylamino]ethoxy]-1,2,3,4-tetrahydronaphthalen-2-yl]carbamate |
| SMILES | CCOC(=O)NC1CCc2ccc(OCCNS(=O)(=O)c3ccn(C)c3)cc2C1Cc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C27H31F2N3O5S/c1-3-36-27(33)31-26-7-5-19-4-6-22(37-11-9-30-38(34,35)23-8-10-32(2)17-23)16-24(19)25(26)14-18-12-20(28)15-21(29)13-18/h4,6,8,10,12-13,15-17,25-26,30H,3,5,7,9,11,14H2,1-2H3,(H,31,33) |
| InChIKey | QZUOGTHMZFUITN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.62 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|