About (3S)-3-amino-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one
(3S)-3-amino-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one (PubChem CID 57471845) has the molecular formula C10H12N2O2
and a molecular weight of 192.22 g/mol. Its IUPAC name is (3S)-3-amino-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one.
Molecular Properties
| Compound Name | (3S)-3-amino-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one |
| PubChem CID | 57471845 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (3S)-3-amino-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one |
| SMILES | CN1C(=O)[C@@H](N)COc2ccccc21 |
| InChI | InChI=1S/C10H12N2O2/c1-12-8-4-2-3-5-9(8)14-6-7(11)10(12)13/h2-5,7H,6,11H2,1H3/t7-/m0/s1 |
| InChIKey | WGQRJYAYYNVCJS-ZETCQYMHSA-N |
| XLogP | 0.37 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-3-amino-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-amino-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one?
The IUPAC name of (3S)-3-amino-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one (CID 57471845) is (3S)-3-amino-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one.
What is the SMILES notation for (3S)-3-amino-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one?
The canonical SMILES for (3S)-3-amino-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one is CN1C(=O)[C@@H](N)COc2ccccc21.
What is the InChIKey of (3S)-3-amino-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one?
The InChIKey is WGQRJYAYYNVCJS-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H12N2O2/c1-12-8-4-2-3-5-9(8)14-6-7(11)10(12)13/h2-5,7H,6,11H2,1H3/t7-/m0/s1.
What are the key properties of (3S)-3-amino-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one?
(3S)-3-amino-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one has a molecular weight of 192.22 g/mol, XLogP of 0.37, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-amino-5-methyl-2,3-dihydro-1,5-benzoxazepin-4-one is sourced from PubChem (CID 57471845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).