About N-[propyl-[2-(2,4,6-trichlorophenoxy)ethyl]carbamoyl]formamide
N-[propyl-[2-(2,4,6-trichlorophenoxy)ethyl]carbamoyl]formamide (PubChem CID 57472173) has the molecular formula C13H15Cl3N2O3
and a molecular weight of 353.63 g/mol. Its IUPAC name is N-[propyl-[2-(2,4,6-trichlorophenoxy)ethyl]carbamoyl]formamide.
Molecular Properties
| Compound Name | N-[propyl-[2-(2,4,6-trichlorophenoxy)ethyl]carbamoyl]formamide |
| PubChem CID | 57472173 |
| Molecular Formula | C13H15Cl3N2O3 |
| Molecular Weight | 353.63 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | N-[propyl-[2-(2,4,6-trichlorophenoxy)ethyl]carbamoyl]formamide |
| SMILES | CCCN(CCOc1c(Cl)cc(Cl)cc1Cl)C(=O)NC=O |
| InChI | InChI=1S/C13H15Cl3N2O3/c1-2-3-18(13(20)17-8-19)4-5-21-12-10(15)6-9(14)7-11(12)16/h6-8H,2-5H2,1H3,(H,17,19,20) |
| InChIKey | RHDVQZWCBQXOJW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.63 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-[propyl-[2-(2,4,6-trichlorophenoxy)ethyl]carbamoyl]formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[propyl-[2-(2,4,6-trichlorophenoxy)ethyl]carbamoyl]formamide?
The IUPAC name of N-[propyl-[2-(2,4,6-trichlorophenoxy)ethyl]carbamoyl]formamide (CID 57472173) is N-[propyl-[2-(2,4,6-trichlorophenoxy)ethyl]carbamoyl]formamide.
What is the SMILES notation for N-[propyl-[2-(2,4,6-trichlorophenoxy)ethyl]carbamoyl]formamide?
The canonical SMILES for N-[propyl-[2-(2,4,6-trichlorophenoxy)ethyl]carbamoyl]formamide is CCCN(CCOc1c(Cl)cc(Cl)cc1Cl)C(=O)NC=O.
What is the InChIKey of N-[propyl-[2-(2,4,6-trichlorophenoxy)ethyl]carbamoyl]formamide?
The InChIKey is RHDVQZWCBQXOJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15Cl3N2O3/c1-2-3-18(13(20)17-8-19)4-5-21-12-10(15)6-9(14)7-11(12)16/h6-8H,2-5H2,1H3,(H,17,19,20).
What are the key properties of N-[propyl-[2-(2,4,6-trichlorophenoxy)ethyl]carbamoyl]formamide?
N-[propyl-[2-(2,4,6-trichlorophenoxy)ethyl]carbamoyl]formamide has a molecular weight of 353.63 g/mol, XLogP of 3.60, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[propyl-[2-(2,4,6-trichlorophenoxy)ethyl]carbamoyl]formamide is sourced from PubChem (CID 57472173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).