C15H19ClN8O — CID 57472238
2-[[7-[(2-amino-6-chlorophenyl)methylamino]-2H-triazolo[4,5-d]pyrimidin-5-yl]amino]butan-1-ol (PubChem CID 57472238) has the molecular formula C15H19ClN8O and a molecular weight of 362.83 g/mol. Its IUPAC name is 2-[[7-[(2-amino-6-chlorophenyl)methylamino]-2H-triazolo[4,5-d]pyrimidin-5-yl]amino]butan-1-ol.
| Compound Name | 2-[[7-[(2-amino-6-chlorophenyl)methylamino]-2H-triazolo[4,5-d]pyrimidin-5-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 57472238 |
| Molecular Formula | C15H19ClN8O |
| Molecular Weight | 362.83 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 2-[[7-[(2-amino-6-chlorophenyl)methylamino]-2H-triazolo[4,5-d]pyrimidin-5-yl]amino]butan-1-ol |
| SMILES | CCC(CO)Nc1nc(NCc2c(N)cccc2Cl)c2n[nH]nc2n1 |
| InChI | InChI=1S/C15H19ClN8O/c1-2-8(7-25)19-15-20-13(12-14(21-15)23-24-22-12)18-6-9-10(16)4-3-5-11(9)17/h3-5,8,25H,2,6-7,17H2,1H3,(H3,18,19,20,21,22,23,24) |
| InChIKey | IZNUDSFMKSFBFO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 137.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.83 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|