C21H24F3N7O4 — CID 57472551
(2,2,2-trifluoroacetyl) (2S)-1-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)pyrrolidine-2-carboxylate (PubChem CID 57472551) has the molecular formula C21H24F3N7O4 and a molecular weight of 495.46 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (2S)-1-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)pyrrolidine-2-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) (2S)-1-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 57472551 |
| Molecular Formula | C21H24F3N7O4 |
| Molecular Weight | 495.46 g/mol |
| Exact Mass | 495.18 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (2S)-1-(7-but-2-ynyl-1-methyl-6-oxo-8-piperazin-1-ylpurin-2-yl)pyrrolidine-2-carboxylate |
| SMILES | CC#CCn1c(N2CCNCC2)nc2nc(N3CCC[C@H]3C(=O)OC(=O)C(F)(F)F)n(C)c(=O)c21 |
| InChI | InChI=1S/C21H24F3N7O4/c1-3-4-9-31-14-15(27-20(31)29-11-7-25-8-12-29)26-19(28(2)16(14)32)30-10-5-6-13(30)17(33)35-18(34)21(22,23)24/h13,25H,5-12H2,1-2H3/t13-/m0/s1 |
| InChIKey | WKQLMNAGCIPSKQ-ZDUSSCGKSA-N |
| XLogP | 0.16 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.46 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|