About 1-pyrrolidin-1-yloctadeca-6,11-dien-1-one
1-pyrrolidin-1-yloctadeca-6,11-dien-1-one (PubChem CID 574727) has the molecular formula C22H39NO
and a molecular weight of 333.56 g/mol. Its IUPAC name is 1-pyrrolidin-1-yloctadeca-6,11-dien-1-one.
Molecular Properties
| Compound Name | 1-pyrrolidin-1-yloctadeca-6,11-dien-1-one |
| PubChem CID | 574727 |
| Molecular Formula | C22H39NO |
| Molecular Weight | 333.56 g/mol |
| Exact Mass | 333.30 |
| IUPAC Name | 1-pyrrolidin-1-yloctadeca-6,11-dien-1-one |
| SMILES | CCCCCCC=CCCCC=CCCCCC(=O)N1CCCC1 |
| InChI | InChI=1S/C22H39NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-22(24)23-20-17-18-21-23/h7-8,12-13H,2-6,9-11,14-21H2,1H3 |
| InChIKey | QQKFUGBRAMWDKQ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 333.56 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-pyrrolidin-1-yloctadeca-6,11-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrrolidin-1-yloctadeca-6,11-dien-1-one?
The IUPAC name of 1-pyrrolidin-1-yloctadeca-6,11-dien-1-one (CID 574727) is 1-pyrrolidin-1-yloctadeca-6,11-dien-1-one.
What is the SMILES notation for 1-pyrrolidin-1-yloctadeca-6,11-dien-1-one?
The canonical SMILES for 1-pyrrolidin-1-yloctadeca-6,11-dien-1-one is CCCCCCC=CCCCC=CCCCCC(=O)N1CCCC1.
What is the InChIKey of 1-pyrrolidin-1-yloctadeca-6,11-dien-1-one?
The InChIKey is QQKFUGBRAMWDKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H39NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-22(24)23-20-17-18-21-23/h7-8,12-13H,2-6,9-11,14-21H2,1H3.
What are the key properties of 1-pyrrolidin-1-yloctadeca-6,11-dien-1-one?
1-pyrrolidin-1-yloctadeca-6,11-dien-1-one has a molecular weight of 333.56 g/mol, XLogP of 6.42, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrrolidin-1-yloctadeca-6,11-dien-1-one is sourced from PubChem (CID 574727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).