About 5-[2-(2-aminophenyl)-2-oxoethyl]-3-but-2-ynyl-2-piperazin-1-ylimidazo[4,5-d]pyridazin-4-one
5-[2-(2-aminophenyl)-2-oxoethyl]-3-but-2-ynyl-2-piperazin-1-ylimidazo[4,5-d]pyridazin-4-one (PubChem CID 57472816) has the molecular formula C21H23N7O2
and a molecular weight of 405.46 g/mol. Its IUPAC name is 5-[2-(2-aminophenyl)-2-oxoethyl]-3-but-2-ynyl-2-piperazin-1-ylimidazo[4,5-d]pyridazin-4-one.
Molecular Properties
| Compound Name | 5-[2-(2-aminophenyl)-2-oxoethyl]-3-but-2-ynyl-2-piperazin-1-ylimidazo[4,5-d]pyridazin-4-one |
| PubChem CID | 57472816 |
| Molecular Formula | C21H23N7O2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 5-[2-(2-aminophenyl)-2-oxoethyl]-3-but-2-ynyl-2-piperazin-1-ylimidazo[4,5-d]pyridazin-4-one |
| SMILES | CC#CCn1c(N2CCNCC2)nc2cnn(CC(=O)c3ccccc3N)c(=O)c21 |
| InChI | InChI=1S/C21H23N7O2/c1-2-3-10-27-19-17(25-21(27)26-11-8-23-9-12-26)13-24-28(20(19)30)14-18(29)15-6-4-5-7-16(15)22/h4-7,13,23H,8-12,14,22H2,1H3 |
| InChIKey | ROOVCPSUOLPUIK-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 111.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-[2-(2-aminophenyl)-2-oxoethyl]-3-but-2-ynyl-2-piperazin-1-ylimidazo[4,5-d]pyridazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(2-aminophenyl)-2-oxoethyl]-3-but-2-ynyl-2-piperazin-1-ylimidazo[4,5-d]pyridazin-4-one?
The IUPAC name of 5-[2-(2-aminophenyl)-2-oxoethyl]-3-but-2-ynyl-2-piperazin-1-ylimidazo[4,5-d]pyridazin-4-one (CID 57472816) is 5-[2-(2-aminophenyl)-2-oxoethyl]-3-but-2-ynyl-2-piperazin-1-ylimidazo[4,5-d]pyridazin-4-one.
What is the SMILES notation for 5-[2-(2-aminophenyl)-2-oxoethyl]-3-but-2-ynyl-2-piperazin-1-ylimidazo[4,5-d]pyridazin-4-one?
The canonical SMILES for 5-[2-(2-aminophenyl)-2-oxoethyl]-3-but-2-ynyl-2-piperazin-1-ylimidazo[4,5-d]pyridazin-4-one is CC#CCn1c(N2CCNCC2)nc2cnn(CC(=O)c3ccccc3N)c(=O)c21.
What is the InChIKey of 5-[2-(2-aminophenyl)-2-oxoethyl]-3-but-2-ynyl-2-piperazin-1-ylimidazo[4,5-d]pyridazin-4-one?
The InChIKey is ROOVCPSUOLPUIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N7O2/c1-2-3-10-27-19-17(25-21(27)26-11-8-23-9-12-26)13-24-28(20(19)30)14-18(29)15-6-4-5-7-16(15)22/h4-7,13,23H,8-12,14,22H2,1H3.
What are the key properties of 5-[2-(2-aminophenyl)-2-oxoethyl]-3-but-2-ynyl-2-piperazin-1-ylimidazo[4,5-d]pyridazin-4-one?
5-[2-(2-aminophenyl)-2-oxoethyl]-3-but-2-ynyl-2-piperazin-1-ylimidazo[4,5-d]pyridazin-4-one has a molecular weight of 405.46 g/mol, XLogP of 0.49, 5 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(2-aminophenyl)-2-oxoethyl]-3-but-2-ynyl-2-piperazin-1-ylimidazo[4,5-d]pyridazin-4-one is sourced from PubChem (CID 57472816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).