C23H21F3N6O4 — CID 57472826
[2-(3-but-2-ynyl-4-oxo-7-phenyl-2-piperazin-1-ylimidazo[4,5-d]pyridazin-5-yl)acetyl] 2,2,2-trifluoroacetate (PubChem CID 57472826) has the molecular formula C23H21F3N6O4 and a molecular weight of 502.45 g/mol. Its IUPAC name is [2-(3-but-2-ynyl-4-oxo-7-phenyl-2-piperazin-1-ylimidazo[4,5-d]pyridazin-5-yl)acetyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-(3-but-2-ynyl-4-oxo-7-phenyl-2-piperazin-1-ylimidazo[4,5-d]pyridazin-5-yl)acetyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 57472826 |
| Molecular Formula | C23H21F3N6O4 |
| Molecular Weight | 502.45 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | [2-(3-but-2-ynyl-4-oxo-7-phenyl-2-piperazin-1-ylimidazo[4,5-d]pyridazin-5-yl)acetyl] 2,2,2-trifluoroacetate |
| SMILES | CC#CCn1c(N2CCNCC2)nc2c(-c3ccccc3)nn(CC(=O)OC(=O)C(F)(F)F)c(=O)c21 |
| InChI | InChI=1S/C23H21F3N6O4/c1-2-3-11-31-19-18(28-22(31)30-12-9-27-10-13-30)17(15-7-5-4-6-8-15)29-32(20(19)34)14-16(33)36-21(35)23(24,25)26/h4-8,27H,9-14H2,1H3 |
| InChIKey | DDTBKLDWQQPOMA-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 111.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.45 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|