C13H22O3 — CID 57473083
2,6,6,10-tetramethyl-1-oxaspiro[4.5]dec-9-ene-2,8-diol (PubChem CID 57473083) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is 2,6,6,10-tetramethyl-1-oxaspiro[4.5]dec-9-ene-2,8-diol.
| Compound Name | 2,6,6,10-tetramethyl-1-oxaspiro[4.5]dec-9-ene-2,8-diol |
|---|---|
| PubChem CID | 57473083 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | 2,6,6,10-tetramethyl-1-oxaspiro[4.5]dec-9-ene-2,8-diol |
| SMILES | CC1=CC(O)CC(C)(C)C12CCC(C)(O)O2 |
| InChI | InChI=1S/C13H22O3/c1-9-7-10(14)8-11(2,3)13(9)6-5-12(4,15)16-13/h7,10,14-15H,5-6,8H2,1-4H3 |
| InChIKey | SJZGKFZUNCXEEW-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|