About 1-hydroxyazepan-4-ol
1-hydroxyazepan-4-ol (PubChem CID 57473453) has the molecular formula C6H13NO2
and a molecular weight of 131.18 g/mol. Its IUPAC name is 1-hydroxyazepan-4-ol.
Molecular Properties
| Compound Name | 1-hydroxyazepan-4-ol |
| PubChem CID | 57473453 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | 1-hydroxyazepan-4-ol |
| SMILES | OC1CCCN(O)CC1 |
| InChI | InChI=1S/C6H13NO2/c8-6-2-1-4-7(9)5-3-6/h6,8-9H,1-5H2 |
| InChIKey | VLGJHSUCLHNLQU-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-hydroxyazepan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxyazepan-4-ol?
The IUPAC name of 1-hydroxyazepan-4-ol (CID 57473453) is 1-hydroxyazepan-4-ol.
What is the SMILES notation for 1-hydroxyazepan-4-ol?
The canonical SMILES for 1-hydroxyazepan-4-ol is OC1CCCN(O)CC1.
What is the InChIKey of 1-hydroxyazepan-4-ol?
The InChIKey is VLGJHSUCLHNLQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2/c8-6-2-1-4-7(9)5-3-6/h6,8-9H,1-5H2.
What are the key properties of 1-hydroxyazepan-4-ol?
1-hydroxyazepan-4-ol has a molecular weight of 131.18 g/mol, XLogP of 0.22, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxyazepan-4-ol is sourced from PubChem (CID 57473453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).