C27H35N3O4 — CID 57473679
[4-[(2-cyclohexylacetyl)amino]phenyl] 4-[(4-methoxyphenyl)methyl]piperazine-1-carboxylate (PubChem CID 57473679) has the molecular formula C27H35N3O4 and a molecular weight of 465.59 g/mol. Its IUPAC name is [4-[(2-cyclohexylacetyl)amino]phenyl] 4-[(4-methoxyphenyl)methyl]piperazine-1-carboxylate.
| Compound Name | [4-[(2-cyclohexylacetyl)amino]phenyl] 4-[(4-methoxyphenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 57473679 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | [4-[(2-cyclohexylacetyl)amino]phenyl] 4-[(4-methoxyphenyl)methyl]piperazine-1-carboxylate |
| SMILES | COc1ccc(CN2CCN(C(=O)Oc3ccc(NC(=O)CC4CCCCC4)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H35N3O4/c1-33-24-11-7-22(8-12-24)20-29-15-17-30(18-16-29)27(32)34-25-13-9-23(10-14-25)28-26(31)19-21-5-3-2-4-6-21/h7-14,21H,2-6,15-20H2,1H3,(H,28,31) |
| InChIKey | VUFDVHSDSCMEFR-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |