About 2-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]acetaldehyde
2-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]acetaldehyde (PubChem CID 57473821) has the molecular formula C18H19F6NO2
and a molecular weight of 395.34 g/mol. Its IUPAC name is 2-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]acetaldehyde.
Molecular Properties
| Compound Name | 2-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]acetaldehyde |
| PubChem CID | 57473821 |
| Molecular Formula | C18H19F6NO2 |
| Molecular Weight | 395.34 g/mol |
| Exact Mass | 395.13 |
| IUPAC Name | 2-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]acetaldehyde |
| SMILES | CC(C)C1(CC=O)CCN(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C18H19F6NO2/c1-11(2)16(4-6-26)3-5-25(15(16)27)10-12-7-13(17(19,20)21)9-14(8-12)18(22,23)24/h6-9,11H,3-5,10H2,1-2H3 |
| InChIKey | KYLUKNCHIMZOHS-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.34 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]acetaldehyde?
The IUPAC name of 2-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]acetaldehyde (CID 57473821) is 2-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]acetaldehyde.
What is the SMILES notation for 2-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]acetaldehyde?
The canonical SMILES for 2-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]acetaldehyde is CC(C)C1(CC=O)CCN(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1=O.
What is the InChIKey of 2-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]acetaldehyde?
The InChIKey is KYLUKNCHIMZOHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19F6NO2/c1-11(2)16(4-6-26)3-5-25(15(16)27)10-12-7-13(17(19,20)21)9-14(8-12)18(22,23)24/h6-9,11H,3-5,10H2,1-2H3.
What are the key properties of 2-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]acetaldehyde?
2-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]acetaldehyde has a molecular weight of 395.34 g/mol, XLogP of 4.69, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]acetaldehyde is sourced from PubChem (CID 57473821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).