About 3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]propanal
3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]propanal (PubChem CID 57473823) has the molecular formula C19H21F6NO2
and a molecular weight of 409.37 g/mol. Its IUPAC name is 3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]propanal.
Molecular Properties
| Compound Name | 3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]propanal |
| PubChem CID | 57473823 |
| Molecular Formula | C19H21F6NO2 |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]propanal |
| SMILES | CC(C)C1(CCC=O)CCN(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1=O |
| InChI | InChI=1S/C19H21F6NO2/c1-12(2)17(4-3-7-27)5-6-26(16(17)28)11-13-8-14(18(20,21)22)10-15(9-13)19(23,24)25/h7-10,12H,3-6,11H2,1-2H3 |
| InChIKey | ZCXYDZLWYWHQGV-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]propanal?
The IUPAC name of 3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]propanal (CID 57473823) is 3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]propanal.
What is the SMILES notation for 3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]propanal?
The canonical SMILES for 3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]propanal is CC(C)C1(CCC=O)CCN(Cc2cc(C(F)(F)F)cc(C(F)(F)F)c2)C1=O.
What is the InChIKey of 3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]propanal?
The InChIKey is ZCXYDZLWYWHQGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21F6NO2/c1-12(2)17(4-3-7-27)5-6-26(16(17)28)11-13-8-14(18(20,21)22)10-15(9-13)19(23,24)25/h7-10,12H,3-6,11H2,1-2H3.
What are the key properties of 3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]propanal?
3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]propanal has a molecular weight of 409.37 g/mol, XLogP of 5.08, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-2-oxo-3-propan-2-ylpyrrolidin-3-yl]propanal is sourced from PubChem (CID 57473823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).