C18H16Cl2F3N3O2S — CID 57473901
2-amino-4,6-dichloro-N-[1,1,1-trifluoro-3-(5-methyl-1H-indol-3-yl)propan-2-yl]benzenesulfonamide (PubChem CID 57473901) has the molecular formula C18H16Cl2F3N3O2S and a molecular weight of 466.31 g/mol. Its IUPAC name is 2-amino-4,6-dichloro-N-[1,1,1-trifluoro-3-(5-methyl-1H-indol-3-yl)propan-2-yl]benzenesulfonamide.
| Compound Name | 2-amino-4,6-dichloro-N-[1,1,1-trifluoro-3-(5-methyl-1H-indol-3-yl)propan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 57473901 |
| Molecular Formula | C18H16Cl2F3N3O2S |
| Molecular Weight | 466.31 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | 2-amino-4,6-dichloro-N-[1,1,1-trifluoro-3-(5-methyl-1H-indol-3-yl)propan-2-yl]benzenesulfonamide |
| SMILES | Cc1ccc2[nH]cc(CC(NS(=O)(=O)c3c(N)cc(Cl)cc3Cl)C(F)(F)F)c2c1 |
| InChI | InChI=1S/C18H16Cl2F3N3O2S/c1-9-2-3-15-12(4-9)10(8-25-15)5-16(18(21,22)23)26-29(27,28)17-13(20)6-11(19)7-14(17)24/h2-4,6-8,16,25-26H,5,24H2,1H3 |
| InChIKey | LQOAYPKBQJBSTA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.31 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|