C19H16Cl2F5N3O2S — CID 57473918
2-amino-4,6-dichloro-N-[3,3,4,4,4-pentafluoro-1-(5-methyl-1H-indol-3-yl)butan-2-yl]benzenesulfonamide (PubChem CID 57473918) has the molecular formula C19H16Cl2F5N3O2S and a molecular weight of 516.32 g/mol. Its IUPAC name is 2-amino-4,6-dichloro-N-[3,3,4,4,4-pentafluoro-1-(5-methyl-1H-indol-3-yl)butan-2-yl]benzenesulfonamide.
| Compound Name | 2-amino-4,6-dichloro-N-[3,3,4,4,4-pentafluoro-1-(5-methyl-1H-indol-3-yl)butan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 57473918 |
| Molecular Formula | C19H16Cl2F5N3O2S |
| Molecular Weight | 516.32 g/mol |
| Exact Mass | 515.03 |
| IUPAC Name | 2-amino-4,6-dichloro-N-[3,3,4,4,4-pentafluoro-1-(5-methyl-1H-indol-3-yl)butan-2-yl]benzenesulfonamide |
| SMILES | Cc1ccc2[nH]cc(CC(NS(=O)(=O)c3c(N)cc(Cl)cc3Cl)C(F)(F)C(F)(F)F)c2c1 |
| InChI | InChI=1S/C19H16Cl2F5N3O2S/c1-9-2-3-15-12(4-9)10(8-28-15)5-16(18(22,23)19(24,25)26)29-32(30,31)17-13(21)6-11(20)7-14(17)27/h2-4,6-8,16,28-29H,5,27H2,1H3 |
| InChIKey | GGGUWZPNGWAGDI-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.32 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|