C20H16Cl2F3N5O2S — CID 57473997
2-amino-4,6-dichloro-N-[1,1,1-trifluoro-3-[3-(1H-pyrazol-5-yl)indol-1-yl]propan-2-yl]benzenesulfonamide (PubChem CID 57473997) has the molecular formula C20H16Cl2F3N5O2S and a molecular weight of 518.35 g/mol. Its IUPAC name is 2-amino-4,6-dichloro-N-[1,1,1-trifluoro-3-[3-(1H-pyrazol-5-yl)indol-1-yl]propan-2-yl]benzenesulfonamide.
| Compound Name | 2-amino-4,6-dichloro-N-[1,1,1-trifluoro-3-[3-(1H-pyrazol-5-yl)indol-1-yl]propan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 57473997 |
| Molecular Formula | C20H16Cl2F3N5O2S |
| Molecular Weight | 518.35 g/mol |
| Exact Mass | 517.04 |
| IUPAC Name | 2-amino-4,6-dichloro-N-[1,1,1-trifluoro-3-[3-(1H-pyrazol-5-yl)indol-1-yl]propan-2-yl]benzenesulfonamide |
| SMILES | Nc1cc(Cl)cc(Cl)c1S(=O)(=O)NC(Cn1cc(-c2ccn[nH]2)c2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C20H16Cl2F3N5O2S/c21-11-7-14(22)19(15(26)8-11)33(31,32)29-18(20(23,24)25)10-30-9-13(16-5-6-27-28-16)12-3-1-2-4-17(12)30/h1-9,18,29H,10,26H2,(H,27,28) |
| InChIKey | NDDIQXIIKRWISE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 105.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.35 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|