C21H18Cl2F3N5O2S — CID 57474001
2-amino-4,6-dichloro-N-[1,1,1-trifluoro-3-[3-(1-methylpyrazol-4-yl)indol-1-yl]propan-2-yl]benzenesulfonamide (PubChem CID 57474001) has the molecular formula C21H18Cl2F3N5O2S and a molecular weight of 532.38 g/mol. Its IUPAC name is 2-amino-4,6-dichloro-N-[1,1,1-trifluoro-3-[3-(1-methylpyrazol-4-yl)indol-1-yl]propan-2-yl]benzenesulfonamide.
| Compound Name | 2-amino-4,6-dichloro-N-[1,1,1-trifluoro-3-[3-(1-methylpyrazol-4-yl)indol-1-yl]propan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 57474001 |
| Molecular Formula | C21H18Cl2F3N5O2S |
| Molecular Weight | 532.38 g/mol |
| Exact Mass | 531.05 |
| IUPAC Name | 2-amino-4,6-dichloro-N-[1,1,1-trifluoro-3-[3-(1-methylpyrazol-4-yl)indol-1-yl]propan-2-yl]benzenesulfonamide |
| SMILES | Cn1cc(-c2cn(CC(NS(=O)(=O)c3c(N)cc(Cl)cc3Cl)C(F)(F)F)c3ccccc23)cn1 |
| InChI | InChI=1S/C21H18Cl2F3N5O2S/c1-30-9-12(8-28-30)15-10-31(18-5-3-2-4-14(15)18)11-19(21(24,25)26)29-34(32,33)20-16(23)6-13(22)7-17(20)27/h2-10,19,29H,11,27H2,1H3 |
| InChIKey | KCVCHISNZRYIJX-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|