C23H17Cl2F4N3O2S — CID 57474003
2-amino-4,6-dichloro-N-[1,1,1-trifluoro-3-[3-(4-fluorophenyl)indol-1-yl]propan-2-yl]benzenesulfonamide (PubChem CID 57474003) has the molecular formula C23H17Cl2F4N3O2S and a molecular weight of 546.37 g/mol. Its IUPAC name is 2-amino-4,6-dichloro-N-[1,1,1-trifluoro-3-[3-(4-fluorophenyl)indol-1-yl]propan-2-yl]benzenesulfonamide.
| Compound Name | 2-amino-4,6-dichloro-N-[1,1,1-trifluoro-3-[3-(4-fluorophenyl)indol-1-yl]propan-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 57474003 |
| Molecular Formula | C23H17Cl2F4N3O2S |
| Molecular Weight | 546.37 g/mol |
| Exact Mass | 545.04 |
| IUPAC Name | 2-amino-4,6-dichloro-N-[1,1,1-trifluoro-3-[3-(4-fluorophenyl)indol-1-yl]propan-2-yl]benzenesulfonamide |
| SMILES | Nc1cc(Cl)cc(Cl)c1S(=O)(=O)NC(Cn1cc(-c2ccc(F)cc2)c2ccccc21)C(F)(F)F |
| InChI | InChI=1S/C23H17Cl2F4N3O2S/c24-14-9-18(25)22(19(30)10-14)35(33,34)31-21(23(27,28)29)12-32-11-17(13-5-7-15(26)8-6-13)16-3-1-2-4-20(16)32/h1-11,21,31H,12,30H2 |
| InChIKey | VLEXDYLXFUEGMR-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.37 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|